C12H18O — CID 164603543
[3-[(1Z)-buta-1,3-dienyl]-2,4-dimethylcyclopent-3-en-1-yl]methanol (PubChem CID 164603543) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is [3-[(1Z)-buta-1,3-dienyl]-2,4-dimethylcyclopent-3-en-1-yl]methanol.
| Compound Name | [3-[(1Z)-buta-1,3-dienyl]-2,4-dimethylcyclopent-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 164603543 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | [3-[(1Z)-buta-1,3-dienyl]-2,4-dimethylcyclopent-3-en-1-yl]methanol |
| SMILES | C=C/C=C\C1=C(C)CC(CO)C1C |
| InChI | InChI=1S/C12H18O/c1-4-5-6-12-9(2)7-11(8-13)10(12)3/h4-6,10-11,13H,1,7-8H2,2-3H3/b6-5- |
| InChIKey | XBRDPINUOSGOSH-WAYWQWQTSA-N |
| XLogP | 2.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|