C14H22O — CID 53253679
[(1S,2S,4R)-2-[(1E,3E)-hexa-1,3,5-trienyl]-4-methylcyclohexyl]methanol (PubChem CID 53253679) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is [(1S,2S,4R)-2-[(1E,3E)-hexa-1,3,5-trienyl]-4-methylcyclohexyl]methanol.
| Compound Name | [(1S,2S,4R)-2-[(1E,3E)-hexa-1,3,5-trienyl]-4-methylcyclohexyl]methanol |
|---|---|
| PubChem CID | 53253679 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | [(1S,2S,4R)-2-[(1E,3E)-hexa-1,3,5-trienyl]-4-methylcyclohexyl]methanol |
| SMILES | C=C/C=C/C=C/[C@@H]1C[C@H](C)CC[C@@H]1CO |
| InChI | InChI=1S/C14H22O/c1-3-4-5-6-7-13-10-12(2)8-9-14(13)11-15/h3-7,12-15H,1,8-11H2,2H3/b5-4+,7-6+/t12-,13-,14-/m1/s1 |
| InChIKey | BPZQLKHNZMVNDF-UHDRKXBWSA-N |
| XLogP | 3.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|