C12H20O — CID 5368931
[2-[(2E)-penta-2,4-dienyl]cyclohexyl]methanol (PubChem CID 5368931) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is [2-[(2E)-penta-2,4-dienyl]cyclohexyl]methanol.
| Compound Name | [2-[(2E)-penta-2,4-dienyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 5368931 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | [2-[(2E)-penta-2,4-dienyl]cyclohexyl]methanol |
| SMILES | C=C/C=C/CC1CCCCC1CO |
| InChI | InChI=1S/C12H20O/c1-2-3-4-7-11-8-5-6-9-12(11)10-13/h2-4,11-13H,1,5-10H2/b4-3+ |
| InChIKey | DBNPIFQVSPHFPM-ONEGZZNKSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|