C9H18O — CID 58154483
[(1R,2R)-2-ethylcyclohexyl]methanol (PubChem CID 58154483) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is [(1R,2R)-2-ethylcyclohexyl]methanol.
| Compound Name | [(1R,2R)-2-ethylcyclohexyl]methanol |
|---|---|
| PubChem CID | 58154483 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | [(1R,2R)-2-ethylcyclohexyl]methanol |
| SMILES | CC[C@@H]1CCCC[C@H]1CO |
| InChI | InChI=1S/C9H18O/c1-2-8-5-3-4-6-9(8)7-10/h8-10H,2-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | PFQQPJMDCDHXJZ-BDAKNGLRSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |