C9H18 — CID 23620237
cis-(1S,2S)-1-ethyl-2-methylcyclohexane (PubChem CID 23620237) has the molecular formula C9H18 and a molecular weight of 126.24 g/mol. Its IUPAC name is cis-(1S,2S)-1-ethyl-2-methylcyclohexane.
| Compound Name | cis-(1S,2S)-1-ethyl-2-methylcyclohexane |
|---|---|
| PubChem CID | 23620237 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | cis-(1S,2S)-1-ethyl-2-methylcyclohexane |
| SMILES | CC[C@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C9H18/c1-3-9-7-5-4-6-8(9)2/h8-9H,3-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | XARGIVYWQPXRTC-IUCAKERBSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |