C18H34 — CID 123341709
2-(2,6-diethylcyclohexyl)-1,3-dimethylcyclohexane (PubChem CID 123341709) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is 2-(2,6-diethylcyclohexyl)-1,3-dimethylcyclohexane.
| Compound Name | 2-(2,6-diethylcyclohexyl)-1,3-dimethylcyclohexane |
|---|---|
| PubChem CID | 123341709 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 2-(2,6-diethylcyclohexyl)-1,3-dimethylcyclohexane |
| SMILES | CCC1CCCC(CC)C1C1C(C)CCCC1C |
| InChI | InChI=1S/C18H34/c1-5-15-11-8-12-16(6-2)18(15)17-13(3)9-7-10-14(17)4/h13-18H,5-12H2,1-4H3 |
| InChIKey | BGEFTCFRAJQDPE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |