C13H30 — CID 143479638
ethane;trans-(1S,2R)-1-ethyl-2-methylcyclohexane (PubChem CID 143479638) has the molecular formula C13H30 and a molecular weight of 186.38 g/mol. Its IUPAC name is ethane;trans-(1S,2R)-1-ethyl-2-methylcyclohexane.
| Compound Name | ethane;trans-(1S,2R)-1-ethyl-2-methylcyclohexane |
|---|---|
| PubChem CID | 143479638 |
| Molecular Formula | C13H30 |
| Molecular Weight | 186.38 g/mol |
| Exact Mass | 186.23 |
| IUPAC Name | ethane;trans-(1S,2R)-1-ethyl-2-methylcyclohexane |
| SMILES | CC.CC.CC[C@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C9H18.2C2H6/c1-3-9-7-5-4-6-8(9)2;2*1-2/h8-9H,3-7H2,1-2H3;2*1-2H3/t8-,9+;;/m1../s1 |
| InChIKey | GRWLVBRGFBNYSC-BPRGXCPLSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |