C24H48O — CID 142160829
1,3-diethyl-2-[(Z)-prop-1-enyl]cyclohexane;ethanol;1-ethyl-2-methylcyclohexane (PubChem CID 142160829) has the molecular formula C24H48O and a molecular weight of 352.65 g/mol. Its IUPAC name is 1,3-diethyl-2-[(Z)-prop-1-enyl]cyclohexane;ethanol;1-ethyl-2-methylcyclohexane.
| Compound Name | 1,3-diethyl-2-[(Z)-prop-1-enyl]cyclohexane;ethanol;1-ethyl-2-methylcyclohexane |
|---|---|
| PubChem CID | 142160829 |
| Molecular Formula | C24H48O |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.37 |
| IUPAC Name | 1,3-diethyl-2-[(Z)-prop-1-enyl]cyclohexane;ethanol;1-ethyl-2-methylcyclohexane |
| SMILES | C/C=C\C1C(CC)CCCC1CC.CCC1CCCCC1C.CCO |
| InChI | InChI=1S/C13H24.C9H18.C2H6O/c1-4-8-13-11(5-2)9-7-10-12(13)6-3;1-3-9-7-5-4-6-8(9)2;1-2-3/h4,8,11-13H,5-7,9-10H2,1-3H3;8-9H,3-7H2,1-2H3;3H,2H2,1H3/b8-4-;; |
| InChIKey | HJIWQCBIVVJMIE-QSELPZCXSA-N |
| XLogP | 7.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|