C7H14 — CID 59954453
trans-(1R,2S)-1-ethyl-2-methylcyclobutane (PubChem CID 59954453) has the molecular formula C7H14 and a molecular weight of 98.19 g/mol. Its IUPAC name is trans-(1R,2S)-1-ethyl-2-methylcyclobutane.
| Compound Name | trans-(1R,2S)-1-ethyl-2-methylcyclobutane |
|---|---|
| PubChem CID | 59954453 |
| Molecular Formula | C7H14 |
| Molecular Weight | 98.19 g/mol |
| Exact Mass | 98.11 |
| IUPAC Name | trans-(1R,2S)-1-ethyl-2-methylcyclobutane |
| SMILES | CC[C@@H]1CC[C@@H]1C |
| InChI | InChI=1S/C7H14/c1-3-7-5-4-6(7)2/h6-7H,3-5H2,1-2H3/t6-,7+/m0/s1 |
| InChIKey | GTNFKYXODAGZPL-NKWVEPMBSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |