C10H20 — CID 145320876
(1S,2S,4S)-2-ethyl-1,4-dimethylcyclohexane (PubChem CID 145320876) has the molecular formula C10H20 and a molecular weight of 140.27 g/mol. Its IUPAC name is (1S,2S,4S)-2-ethyl-1,4-dimethylcyclohexane.
| Compound Name | (1S,2S,4S)-2-ethyl-1,4-dimethylcyclohexane |
|---|---|
| PubChem CID | 145320876 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | (1S,2S,4S)-2-ethyl-1,4-dimethylcyclohexane |
| SMILES | CC[C@H]1C[C@@H](C)CC[C@@H]1C |
| InChI | InChI=1S/C10H20/c1-4-10-7-8(2)5-6-9(10)3/h8-10H,4-7H2,1-3H3/t8-,9-,10-/m0/s1 |
| InChIKey | YSLKXMCOTLLYSD-GUBZILKMSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |