C13H28 — CID 144921835
butane;1-ethyl-2,3-dimethylcyclopentane (PubChem CID 144921835) has the molecular formula C13H28 and a molecular weight of 184.37 g/mol. Its IUPAC name is butane;1-ethyl-2,3-dimethylcyclopentane.
| Compound Name | butane;1-ethyl-2,3-dimethylcyclopentane |
|---|---|
| PubChem CID | 144921835 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | butane;1-ethyl-2,3-dimethylcyclopentane |
| SMILES | CCC1CCC(C)C1C.CCCC |
| InChI | InChI=1S/C9H18.C4H10/c1-4-9-6-5-7(2)8(9)3;1-3-4-2/h7-9H,4-6H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | OJVGGLHVYDCLIK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |