C10H22O — CID 142059714
cis-(2S,5S)-2-ethyl-5-methylcyclopentan-1-ol;ethane (PubChem CID 142059714) has the molecular formula C10H22O and a molecular weight of 158.28 g/mol. Its IUPAC name is cis-(2S,5S)-2-ethyl-5-methylcyclopentan-1-ol;ethane.
| Compound Name | cis-(2S,5S)-2-ethyl-5-methylcyclopentan-1-ol;ethane |
|---|---|
| PubChem CID | 142059714 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | cis-(2S,5S)-2-ethyl-5-methylcyclopentan-1-ol;ethane |
| SMILES | CC.CC[C@H]1CC[C@H](C)C1O |
| InChI | InChI=1S/C8H16O.C2H6/c1-3-7-5-4-6(2)8(7)9;1-2/h6-9H,3-5H2,1-2H3;1-2H3/t6-,7-,8?;/m0./s1 |
| InChIKey | WDVDHLDSWWPTFT-NKGRROCASA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |