C13H28O — CID 143693119
1,4-dimethyl-2-(2-methylpropyl)cyclohexane;methanol (PubChem CID 143693119) has the molecular formula C13H28O and a molecular weight of 200.37 g/mol. Its IUPAC name is 1,4-dimethyl-2-(2-methylpropyl)cyclohexane;methanol.
| Compound Name | 1,4-dimethyl-2-(2-methylpropyl)cyclohexane;methanol |
|---|---|
| PubChem CID | 143693119 |
| Molecular Formula | C13H28O |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.21 |
| IUPAC Name | 1,4-dimethyl-2-(2-methylpropyl)cyclohexane;methanol |
| SMILES | CC(C)CC1CC(C)CCC1C.CO |
| InChI | InChI=1S/C12H24.CH4O/c1-9(2)7-12-8-10(3)5-6-11(12)4;1-2/h9-12H,5-8H2,1-4H3;2H,1H3 |
| InChIKey | BTERCSSUGSDOLN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |