About 1-methyl-2-(2-methylpropyl)cyclohexane;nonane
1-methyl-2-(2-methylpropyl)cyclohexane;nonane (PubChem CID 142044958) has the molecular formula C20H42
and a molecular weight of 282.56 g/mol. Its IUPAC name is 1-methyl-2-(2-methylpropyl)cyclohexane;nonane.
Molecular Properties
| Compound Name | 1-methyl-2-(2-methylpropyl)cyclohexane;nonane |
| PubChem CID | 142044958 |
| Molecular Formula | C20H42 |
| Molecular Weight | 282.56 g/mol |
| Exact Mass | 282.33 |
| IUPAC Name | 1-methyl-2-(2-methylpropyl)cyclohexane;nonane |
| SMILES | CC(C)CC1CCCCC1C.CCCCCCCCC |
| InChI | InChI=1S/C11H22.C9H20/c1-9(2)8-11-7-5-4-6-10(11)3;1-3-5-7-9-8-6-4-2/h9-11H,4-8H2,1-3H3;3-9H2,1-2H3 |
| InChIKey | CTWFZSSUUZGAHK-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.56 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-(2-methylpropyl)cyclohexane;nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(2-methylpropyl)cyclohexane;nonane?
The IUPAC name of 1-methyl-2-(2-methylpropyl)cyclohexane;nonane (CID 142044958) is 1-methyl-2-(2-methylpropyl)cyclohexane;nonane.
What is the SMILES notation for 1-methyl-2-(2-methylpropyl)cyclohexane;nonane?
The canonical SMILES for 1-methyl-2-(2-methylpropyl)cyclohexane;nonane is CC(C)CC1CCCCC1C.CCCCCCCCC.
What is the InChIKey of 1-methyl-2-(2-methylpropyl)cyclohexane;nonane?
The InChIKey is CTWFZSSUUZGAHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22.C9H20/c1-9(2)8-11-7-5-4-6-10(11)3;1-3-5-7-9-8-6-4-2/h9-11H,4-8H2,1-3H3;3-9H2,1-2H3.
What are the key properties of 1-methyl-2-(2-methylpropyl)cyclohexane;nonane?
1-methyl-2-(2-methylpropyl)cyclohexane;nonane has a molecular weight of 282.56 g/mol, XLogP of 7.62, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(2-methylpropyl)cyclohexane;nonane is sourced from PubChem (CID 142044958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).