About 1-methyl-2-nonylcycloheptane;2-methylpentanal
1-methyl-2-nonylcycloheptane;2-methylpentanal (PubChem CID 174407340) has the molecular formula C23H46O
and a molecular weight of 338.62 g/mol. Its IUPAC name is 1-methyl-2-nonylcycloheptane;2-methylpentanal.
Molecular Properties
| Compound Name | 1-methyl-2-nonylcycloheptane;2-methylpentanal |
| PubChem CID | 174407340 |
| Molecular Formula | C23H46O |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 338.35 |
| IUPAC Name | 1-methyl-2-nonylcycloheptane;2-methylpentanal |
| SMILES | CCCC(C)C=O.CCCCCCCCCC1CCCCCC1C |
| InChI | InChI=1S/C17H34.C6H12O/c1-3-4-5-6-7-8-11-14-17-15-12-9-10-13-16(17)2;1-3-4-6(2)5-7/h16-17H,3-15H2,1-2H3;5-6H,3-4H2,1-2H3 |
| InChIKey | HHRLAZCTYKYDBY-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-nonylcycloheptane;2-methylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-nonylcycloheptane;2-methylpentanal?
The IUPAC name of 1-methyl-2-nonylcycloheptane;2-methylpentanal (CID 174407340) is 1-methyl-2-nonylcycloheptane;2-methylpentanal.
What is the SMILES notation for 1-methyl-2-nonylcycloheptane;2-methylpentanal?
The canonical SMILES for 1-methyl-2-nonylcycloheptane;2-methylpentanal is CCCC(C)C=O.CCCCCCCCCC1CCCCCC1C.
What is the InChIKey of 1-methyl-2-nonylcycloheptane;2-methylpentanal?
The InChIKey is HHRLAZCTYKYDBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34.C6H12O/c1-3-4-5-6-7-8-11-14-17-15-12-9-10-13-16(17)2;1-3-4-6(2)5-7/h16-17H,3-15H2,1-2H3;5-6H,3-4H2,1-2H3.
What are the key properties of 1-methyl-2-nonylcycloheptane;2-methylpentanal?
1-methyl-2-nonylcycloheptane;2-methylpentanal has a molecular weight of 338.62 g/mol, XLogP of 7.97, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-nonylcycloheptane;2-methylpentanal is sourced from PubChem (CID 174407340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).