C20H36 — CID 71440000
1,4,7-trimethyl-3-(2-methylpropyl)-2,3,3a,4,5,6,6a,7,8,9,9a,9b-dodecahydro-1H-phenalene (PubChem CID 71440000) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is 1,4,7-trimethyl-3-(2-methylpropyl)-2,3,3a,4,5,6,6a,7,8,9,9a,9b-dodecahydro-1H-phenalene.
| Compound Name | 1,4,7-trimethyl-3-(2-methylpropyl)-2,3,3a,4,5,6,6a,7,8,9,9a,9b-dodecahydro-1H-phenalene |
|---|---|
| PubChem CID | 71440000 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 1,4,7-trimethyl-3-(2-methylpropyl)-2,3,3a,4,5,6,6a,7,8,9,9a,9b-dodecahydro-1H-phenalene |
| SMILES | CC(C)CC1CC(C)C2CCC(C)C3CCC(C)C1C32 |
| InChI | InChI=1S/C20H36/c1-12(2)10-16-11-15(5)18-8-6-13(3)17-9-7-14(4)19(16)20(17)18/h12-20H,6-11H2,1-5H3 |
| InChIKey | DCSDOAXTOMXXSV-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |