C13H26O6 — CID 71398880
acetic acid;[(1R,2R)-2-(hydroxymethyl)cycloheptyl]methanol (PubChem CID 71398880) has the molecular formula C13H26O6 and a molecular weight of 278.34 g/mol. Its IUPAC name is acetic acid;[(1R,2R)-2-(hydroxymethyl)cycloheptyl]methanol.
| Compound Name | acetic acid;[(1R,2R)-2-(hydroxymethyl)cycloheptyl]methanol |
|---|---|
| PubChem CID | 71398880 |
| Molecular Formula | C13H26O6 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | acetic acid;[(1R,2R)-2-(hydroxymethyl)cycloheptyl]methanol |
| SMILES | CC(=O)O.CC(=O)O.OC[C@@H]1CCCCC[C@H]1CO |
| InChI | InChI=1S/C9H18O2.2C2H4O2/c10-6-8-4-2-1-3-5-9(8)7-11;2*1-2(3)4/h8-11H,1-7H2;2*1H3,(H,3,4)/t8-,9-;;/m0../s1 |
| InChIKey | KUVPRQMMZVYXFG-CDEWPDHBSA-N |
| XLogP | 1.35 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |