C9H15IO2 — CID 153399735
2-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]acetyl iodide (PubChem CID 153399735) has the molecular formula C9H15IO2 and a molecular weight of 282.12 g/mol. Its IUPAC name is 2-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]acetyl iodide.
| Compound Name | 2-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]acetyl iodide |
|---|---|
| PubChem CID | 153399735 |
| Molecular Formula | C9H15IO2 |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 2-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]acetyl iodide |
| SMILES | O=C(I)C[C@H]1CCCC[C@@H]1CO |
| InChI | InChI=1S/C9H15IO2/c10-9(12)5-7-3-1-2-4-8(7)6-11/h7-8,11H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | WAFVJPKOXPGKHP-HTQZYQBOSA-N |
| XLogP | 2.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|