C11H23N3O2 — CID 103255271
2-amino-3-[[2-(hydroxymethyl)cyclohexyl]methylamino]propanamide (PubChem CID 103255271) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-amino-3-[[2-(hydroxymethyl)cyclohexyl]methylamino]propanamide.
| Compound Name | 2-amino-3-[[2-(hydroxymethyl)cyclohexyl]methylamino]propanamide |
|---|---|
| PubChem CID | 103255271 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 2-amino-3-[[2-(hydroxymethyl)cyclohexyl]methylamino]propanamide |
| SMILES | NC(=O)C(N)CNCC1CCCCC1CO |
| InChI | InChI=1S/C11H23N3O2/c12-10(11(13)16)6-14-5-8-3-1-2-4-9(8)7-15/h8-10,14-15H,1-7,12H2,(H2,13,16) |
| InChIKey | FKDWRGBVJBBFDT-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |