C10H22N4O — CID 103244493
2-amino-3-[(1-methylpiperidin-2-yl)methylamino]propanamide (PubChem CID 103244493) has the molecular formula C10H22N4O and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-amino-3-[(1-methylpiperidin-2-yl)methylamino]propanamide.
| Compound Name | 2-amino-3-[(1-methylpiperidin-2-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 103244493 |
| Molecular Formula | C10H22N4O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2-amino-3-[(1-methylpiperidin-2-yl)methylamino]propanamide |
| SMILES | CN1CCCCC1CNCC(N)C(N)=O |
| InChI | InChI=1S/C10H22N4O/c1-14-5-3-2-4-8(14)6-13-7-9(11)10(12)15/h8-9,13H,2-7,11H2,1H3,(H2,12,15) |
| InChIKey | NJSBXWBNZFGLHO-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |