About dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol
dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol (PubChem CID 163689095) has the molecular formula C11H22O5
and a molecular weight of 234.29 g/mol. Its IUPAC name is dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol.
Molecular Properties
| Compound Name | dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol |
| PubChem CID | 163689095 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol |
| SMILES | COC(=O)OC.OCC1CCCCC1CO |
| InChI | InChI=1S/C8H16O2.C3H6O3/c9-5-7-3-1-2-4-8(7)6-10;1-5-3(4)6-2/h7-10H,1-6H2;1-2H3 |
| InChIKey | JRKLOKLLWHIOHE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol?
The IUPAC name of dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol (CID 163689095) is dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol.
What is the SMILES notation for dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol?
The canonical SMILES for dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol is COC(=O)OC.OCC1CCCCC1CO.
What is the InChIKey of dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol?
The InChIKey is JRKLOKLLWHIOHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C3H6O3/c9-5-7-3-1-2-4-8(7)6-10;1-5-3(4)6-2/h7-10H,1-6H2;1-2H3.
What are the key properties of dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol?
dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol has a molecular weight of 234.29 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl carbonate;[2-(hydroxymethyl)cyclohexyl]methanol is sourced from PubChem (CID 163689095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).