C12H24O6 — CID 70579518
carbonic acid;1,2-diethylcyclohexane (PubChem CID 70579518) has the molecular formula C12H24O6 and a molecular weight of 264.32 g/mol. Its IUPAC name is carbonic acid;1,2-diethylcyclohexane.
| Compound Name | carbonic acid;1,2-diethylcyclohexane |
|---|---|
| PubChem CID | 70579518 |
| Molecular Formula | C12H24O6 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | carbonic acid;1,2-diethylcyclohexane |
| SMILES | CCC1CCCCC1CC.O=C(O)O.O=C(O)O |
| InChI | InChI=1S/C10H20.2CH2O3/c1-3-9-7-5-6-8-10(9)4-2;2*2-1(3)4/h9-10H,3-8H2,1-2H3;2*(H2,2,3,4) |
| InChIKey | ZPUYEGWEUWKNLS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |