C12H17NO — CID 143584516
N-[2-[(1Z)-buta-1,3-dienyl]-3-methylcyclohex-2-en-1-yl]formamide (PubChem CID 143584516) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is N-[2-[(1Z)-buta-1,3-dienyl]-3-methylcyclohex-2-en-1-yl]formamide.
| Compound Name | N-[2-[(1Z)-buta-1,3-dienyl]-3-methylcyclohex-2-en-1-yl]formamide |
|---|---|
| PubChem CID | 143584516 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-[2-[(1Z)-buta-1,3-dienyl]-3-methylcyclohex-2-en-1-yl]formamide |
| SMILES | C=C/C=C\C1=C(C)CCCC1NC=O |
| InChI | InChI=1S/C12H17NO/c1-3-4-7-11-10(2)6-5-8-12(11)13-9-14/h3-4,7,9,12H,1,5-6,8H2,2H3,(H,13,14)/b7-4- |
| InChIKey | CGHLEQQADNXYTM-DAXSKMNVSA-N |
| XLogP | 2.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|