C11H19N — CID 145474616
5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydro-1H-pyrrole;ethane (PubChem CID 145474616) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydro-1H-pyrrole;ethane.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydro-1H-pyrrole;ethane |
|---|---|
| PubChem CID | 145474616 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydro-1H-pyrrole;ethane |
| SMILES | C=C/C=C\C1=C(C)CCN1.CC |
| InChI | InChI=1S/C9H13N.C2H6/c1-3-4-5-9-8(2)6-7-10-9;1-2/h3-5,10H,1,6-7H2,2H3;1-2H3/b5-4-; |
| InChIKey | OSDFUYZYCRACBT-MKWAYWHRSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|