C15H19NO — CID 143060410
3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-1,4-benzoxazine;ethane (PubChem CID 143060410) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-1,4-benzoxazine;ethane.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-1,4-benzoxazine;ethane |
|---|---|
| PubChem CID | 143060410 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-2-methyl-4H-1,4-benzoxazine;ethane |
| SMILES | C=C/C=C\C1=C(C)Oc2ccccc2N1.CC |
| InChI | InChI=1S/C13H13NO.C2H6/c1-3-4-7-11-10(2)15-13-9-6-5-8-12(13)14-11;1-2/h3-9,14H,1H2,2H3;1-2H3/b7-4-; |
| InChIKey | KWCBGUPCAOXGAH-ZULQGGHCSA-N |
| XLogP | 4.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|