C17H27NO — CID 143071380
ethane;2-ethyl-3-[(Z)-prop-1-enyl]-4H-1,4-benzoxazine (PubChem CID 143071380) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is ethane;2-ethyl-3-[(Z)-prop-1-enyl]-4H-1,4-benzoxazine.
| Compound Name | ethane;2-ethyl-3-[(Z)-prop-1-enyl]-4H-1,4-benzoxazine |
|---|---|
| PubChem CID | 143071380 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | ethane;2-ethyl-3-[(Z)-prop-1-enyl]-4H-1,4-benzoxazine |
| SMILES | C/C=C\C1=C(CC)Oc2ccccc2N1.CC.CC |
| InChI | InChI=1S/C13H15NO.2C2H6/c1-3-7-10-12(4-2)15-13-9-6-5-8-11(13)14-10;2*1-2/h3,5-9,14H,4H2,1-2H3;2*1-2H3/b7-3-;; |
| InChIKey | OZWMGMZJVJIKHM-NAMRTZQUSA-N |
| XLogP | 5.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |