About N,N-diphenylaniline;10H-phenoxazine
N,N-diphenylaniline;10H-phenoxazine (PubChem CID 174810342) has the molecular formula C30H24N2O
and a molecular weight of 428.54 g/mol. Its IUPAC name is N,N-diphenylaniline;10H-phenoxazine.
Molecular Properties
| Compound Name | N,N-diphenylaniline;10H-phenoxazine |
| PubChem CID | 174810342 |
| Molecular Formula | C30H24N2O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N,N-diphenylaniline;10H-phenoxazine |
| SMILES | c1ccc(N(c2ccccc2)c2ccccc2)cc1.c1ccc2c(c1)Nc1ccccc1O2 |
| InChI | InChI=1S/C18H15N.C12H9NO/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-15H;1-8,13H |
| InChIKey | SBQHZNZQRKHMAN-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diphenylaniline;10H-phenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diphenylaniline;10H-phenoxazine?
The IUPAC name of N,N-diphenylaniline;10H-phenoxazine (CID 174810342) is N,N-diphenylaniline;10H-phenoxazine.
What is the SMILES notation for N,N-diphenylaniline;10H-phenoxazine?
The canonical SMILES for N,N-diphenylaniline;10H-phenoxazine is c1ccc(N(c2ccccc2)c2ccccc2)cc1.c1ccc2c(c1)Nc1ccccc1O2.
What is the InChIKey of N,N-diphenylaniline;10H-phenoxazine?
The InChIKey is SBQHZNZQRKHMAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N.C12H9NO/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-15H;1-8,13H.
What are the key properties of N,N-diphenylaniline;10H-phenoxazine?
N,N-diphenylaniline;10H-phenoxazine has a molecular weight of 428.54 g/mol, XLogP of 8.69, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diphenylaniline;10H-phenoxazine is sourced from PubChem (CID 174810342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).