About 10H-phenoxazine;thiophene 1,1-dioxide
10H-phenoxazine;thiophene 1,1-dioxide (PubChem CID 159670963) has the molecular formula C16H13NO3S
and a molecular weight of 299.35 g/mol. Its IUPAC name is 10H-phenoxazine;thiophene 1,1-dioxide.
Molecular Properties
| Compound Name | 10H-phenoxazine;thiophene 1,1-dioxide |
| PubChem CID | 159670963 |
| Molecular Formula | C16H13NO3S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 10H-phenoxazine;thiophene 1,1-dioxide |
| SMILES | O=S1(=O)C=CC=C1.c1ccc2c(c1)Nc1ccccc1O2 |
| InChI | InChI=1S/C12H9NO.C4H4O2S/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;5-7(6)3-1-2-4-7/h1-8,13H;1-4H |
| InChIKey | MTZMIOUHMUNUOR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10H-phenoxazine;thiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-phenoxazine;thiophene 1,1-dioxide?
The IUPAC name of 10H-phenoxazine;thiophene 1,1-dioxide (CID 159670963) is 10H-phenoxazine;thiophene 1,1-dioxide.
What is the SMILES notation for 10H-phenoxazine;thiophene 1,1-dioxide?
The canonical SMILES for 10H-phenoxazine;thiophene 1,1-dioxide is O=S1(=O)C=CC=C1.c1ccc2c(c1)Nc1ccccc1O2.
What is the InChIKey of 10H-phenoxazine;thiophene 1,1-dioxide?
The InChIKey is MTZMIOUHMUNUOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO.C4H4O2S/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;5-7(6)3-1-2-4-7/h1-8,13H;1-4H.
What are the key properties of 10H-phenoxazine;thiophene 1,1-dioxide?
10H-phenoxazine;thiophene 1,1-dioxide has a molecular weight of 299.35 g/mol, XLogP of 3.98, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-phenoxazine;thiophene 1,1-dioxide is sourced from PubChem (CID 159670963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).