About 2-propan-2-ylidene-3H-1,3-benzoxazole
2-propan-2-ylidene-3H-1,3-benzoxazole (PubChem CID 146214721) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-propan-2-ylidene-3H-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-propan-2-ylidene-3H-1,3-benzoxazole |
| PubChem CID | 146214721 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2-propan-2-ylidene-3H-1,3-benzoxazole |
| SMILES | CC(C)=C1Nc2ccccc2O1 |
| InChI | InChI=1S/C10H11NO/c1-7(2)10-11-8-5-3-4-6-9(8)12-10/h3-6,11H,1-2H3 |
| InChIKey | IFUIWRNBHRXVCJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-ylidene-3H-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylidene-3H-1,3-benzoxazole?
The IUPAC name of 2-propan-2-ylidene-3H-1,3-benzoxazole (CID 146214721) is 2-propan-2-ylidene-3H-1,3-benzoxazole.
What is the SMILES notation for 2-propan-2-ylidene-3H-1,3-benzoxazole?
The canonical SMILES for 2-propan-2-ylidene-3H-1,3-benzoxazole is CC(C)=C1Nc2ccccc2O1.
What is the InChIKey of 2-propan-2-ylidene-3H-1,3-benzoxazole?
The InChIKey is IFUIWRNBHRXVCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-7(2)10-11-8-5-3-4-6-9(8)12-10/h3-6,11H,1-2H3.
What are the key properties of 2-propan-2-ylidene-3H-1,3-benzoxazole?
2-propan-2-ylidene-3H-1,3-benzoxazole has a molecular weight of 161.20 g/mol, XLogP of 2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylidene-3H-1,3-benzoxazole is sourced from PubChem (CID 146214721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).