About 2-ethyl-10H-phenoxazine
2-ethyl-10H-phenoxazine (PubChem CID 172732916) has the molecular formula C14H13NO
and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-ethyl-10H-phenoxazine.
Molecular Properties
| Compound Name | 2-ethyl-10H-phenoxazine |
| PubChem CID | 172732916 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-ethyl-10H-phenoxazine |
| SMILES | CCc1ccc2c(c1)Nc1ccccc1O2 |
| InChI | InChI=1S/C14H13NO/c1-2-10-7-8-14-12(9-10)15-11-5-3-4-6-13(11)16-14/h3-9,15H,2H2,1H3 |
| InChIKey | IAQDBQTZTKZNKQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-10H-phenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-10H-phenoxazine?
The IUPAC name of 2-ethyl-10H-phenoxazine (CID 172732916) is 2-ethyl-10H-phenoxazine.
What is the SMILES notation for 2-ethyl-10H-phenoxazine?
The canonical SMILES for 2-ethyl-10H-phenoxazine is CCc1ccc2c(c1)Nc1ccccc1O2.
What is the InChIKey of 2-ethyl-10H-phenoxazine?
The InChIKey is IAQDBQTZTKZNKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO/c1-2-10-7-8-14-12(9-10)15-11-5-3-4-6-13(11)16-14/h3-9,15H,2H2,1H3.
What are the key properties of 2-ethyl-10H-phenoxazine?
2-ethyl-10H-phenoxazine has a molecular weight of 211.26 g/mol, XLogP of 4.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-10H-phenoxazine is sourced from PubChem (CID 172732916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).