C8H9NO2 — CID 177309754
5-ethyl-1,3,2-benzodioxazole (PubChem CID 177309754) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 5-ethyl-1,3,2-benzodioxazole.
| Compound Name | 5-ethyl-1,3,2-benzodioxazole |
|---|---|
| PubChem CID | 177309754 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 5-ethyl-1,3,2-benzodioxazole |
| SMILES | CCc1ccc2c(c1)ONO2 |
| InChI | InChI=1S/C8H9NO2/c1-2-6-3-4-7-8(5-6)11-9-10-7/h3-5,9H,2H2,1H3 |
| InChIKey | DTUMPMRLVMKCHY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |