About (5Z,6Z)-2-ethyl-5,6-di(ethylidene)cyclohexa-1,3-diene
(5Z,6Z)-2-ethyl-5,6-di(ethylidene)cyclohexa-1,3-diene (PubChem CID 142245791) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is (5Z,6Z)-2-ethyl-5,6-di(ethylidene)cyclohexa-1,3-diene.
Analyze (5Z,6Z)-2-ethyl-5,6-di(ethylidene)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,6Z)-2-ethyl-5,6-di(ethylidene)cyclohexa-1,3-diene?
The IUPAC name of (5Z,6Z)-2-ethyl-5,6-di(ethylidene)cyclohexa-1,3-diene (CID 142245791) is (5Z,6Z)-2-ethyl-5,6-di(ethylidene)cyclohexa-1,3-diene.
What is the SMILES notation for (5Z,6Z)-2-ethyl-5,6-di(ethylidene)cyclohexa-1,3-diene?
The canonical SMILES for (5Z,6Z)-2-ethyl-5,6-di(ethylidene)cyclohexa-1,3-diene is C/C=c1/ccc(CC)c/c1=C/C.
What is the InChIKey of (5Z,6Z)-2-ethyl-5,6-di(ethylidene)cyclohexa-1,3-diene?
The InChIKey is BVOHDWKKPXUVBC-CBIKUMSCSA-N. The full InChI is InChI=1S/C12H16/c1-4-10-7-8-11(5-2)12(6-3)9-10/h5-9H,4H2,1-3H3/b11-5-,12-6-.
What are the key properties of (5Z,6Z)-2-ethyl-5,6-di(ethylidene)cyclohexa-1,3-diene?
(5Z,6Z)-2-ethyl-5,6-di(ethylidene)cyclohexa-1,3-diene has a molecular weight of 160.26 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,6Z)-2-ethyl-5,6-di(ethylidene)cyclohexa-1,3-diene is sourced from PubChem (CID 142245791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).