About acetaldehyde;4-ethyl-2-methylphenol
acetaldehyde;4-ethyl-2-methylphenol (PubChem CID 143589394) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is acetaldehyde;4-ethyl-2-methylphenol.
Molecular Properties
| Compound Name | acetaldehyde;4-ethyl-2-methylphenol |
| PubChem CID | 143589394 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | acetaldehyde;4-ethyl-2-methylphenol |
| SMILES | CC=O.CCc1ccc(O)c(C)c1 |
| InChI | InChI=1S/C9H12O.C2H4O/c1-3-8-4-5-9(10)7(2)6-8;1-2-3/h4-6,10H,3H2,1-2H3;2H,1H3 |
| InChIKey | UNMKSNYTFSSYEJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;4-ethyl-2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;4-ethyl-2-methylphenol?
The IUPAC name of acetaldehyde;4-ethyl-2-methylphenol (CID 143589394) is acetaldehyde;4-ethyl-2-methylphenol.
What is the SMILES notation for acetaldehyde;4-ethyl-2-methylphenol?
The canonical SMILES for acetaldehyde;4-ethyl-2-methylphenol is CC=O.CCc1ccc(O)c(C)c1.
What is the InChIKey of acetaldehyde;4-ethyl-2-methylphenol?
The InChIKey is UNMKSNYTFSSYEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C2H4O/c1-3-8-4-5-9(10)7(2)6-8;1-2-3/h4-6,10H,3H2,1-2H3;2H,1H3.
What are the key properties of acetaldehyde;4-ethyl-2-methylphenol?
acetaldehyde;4-ethyl-2-methylphenol has a molecular weight of 180.25 g/mol, XLogP of 2.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;4-ethyl-2-methylphenol is sourced from PubChem (CID 143589394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).