C12H21O4P — CID 174758870
butane;(4-hydroxy-3-methylphenyl)methylphosphonic acid (PubChem CID 174758870) has the molecular formula C12H21O4P and a molecular weight of 260.27 g/mol. Its IUPAC name is butane;(4-hydroxy-3-methylphenyl)methylphosphonic acid.
| Compound Name | butane;(4-hydroxy-3-methylphenyl)methylphosphonic acid |
|---|---|
| PubChem CID | 174758870 |
| Molecular Formula | C12H21O4P |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | butane;(4-hydroxy-3-methylphenyl)methylphosphonic acid |
| SMILES | CCCC.Cc1cc(CP(=O)(O)O)ccc1O |
| InChI | InChI=1S/C8H11O4P.C4H10/c1-6-4-7(2-3-8(6)9)5-13(10,11)12;1-3-4-2/h2-4,9H,5H2,1H3,(H2,10,11,12);3-4H2,1-2H3 |
| InChIKey | CLTPUVZESAUFPH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|