C10H11ClN2 — CID 14096341
2-(chloromethyl)-6-ethyl-1H-benzimidazole (PubChem CID 14096341) has the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. Its IUPAC name is 2-(chloromethyl)-6-ethyl-1H-benzimidazole.
| Compound Name | 2-(chloromethyl)-6-ethyl-1H-benzimidazole |
|---|---|
| PubChem CID | 14096341 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-(chloromethyl)-6-ethyl-1H-benzimidazole |
| SMILES | CCc1ccc2nc(CCl)[nH]c2c1 |
| InChI | InChI=1S/C10H11ClN2/c1-2-7-3-4-8-9(5-7)13-10(6-11)12-8/h3-5H,2,6H2,1H3,(H,12,13) |
| InChIKey | PBNFCSATWFZVLP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|