C14H25NO — CID 142558688
ethane;7-ethyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 142558688) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;7-ethyl-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | ethane;7-ethyl-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 142558688 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | ethane;7-ethyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CC.CC.CCc1ccc2c(c1)OCCN2 |
| InChI | InChI=1S/C10H13NO.2C2H6/c1-2-8-3-4-9-10(7-8)12-6-5-11-9;2*1-2/h3-4,7,11H,2,5-6H2,1H3;2*1-2H3 |
| InChIKey | QRQJIMIUJMXGDP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |