C16H15NO2 — CID 166541088
4-(3,4-dihydro-2H-1,4-benzoxazin-7-ylmethyl)benzaldehyde (PubChem CID 166541088) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-1,4-benzoxazin-7-ylmethyl)benzaldehyde.
| Compound Name | 4-(3,4-dihydro-2H-1,4-benzoxazin-7-ylmethyl)benzaldehyde |
|---|---|
| PubChem CID | 166541088 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-(3,4-dihydro-2H-1,4-benzoxazin-7-ylmethyl)benzaldehyde |
| SMILES | O=Cc1ccc(Cc2ccc3c(c2)OCCN3)cc1 |
| InChI | InChI=1S/C16H15NO2/c18-11-13-3-1-12(2-4-13)9-14-5-6-15-16(10-14)19-8-7-17-15/h1-6,10-11,17H,7-9H2 |
| InChIKey | KQKNQJNCCGFZNM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|