C11H13NO2 — CID 130009664
8-ethyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 130009664) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 8-ethyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
| Compound Name | 8-ethyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 130009664 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 8-ethyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | CCc1ccc2c(c1)OCCC(=O)N2 |
| InChI | InChI=1S/C11H13NO2/c1-2-8-3-4-9-10(7-8)14-6-5-11(13)12-9/h3-4,7H,2,5-6H2,1H3,(H,12,13) |
| InChIKey | FCCVMEQSEBOCHW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |