C14H23NO3 — CID 90923836
ethane;2-(2-hydroxyethyl)-4H-1,4-benzoxazin-3-one (PubChem CID 90923836) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is ethane;2-(2-hydroxyethyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | ethane;2-(2-hydroxyethyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 90923836 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | ethane;2-(2-hydroxyethyl)-4H-1,4-benzoxazin-3-one |
| SMILES | CC.CC.O=C1Nc2ccccc2OC1CCO |
| InChI | InChI=1S/C10H11NO3.2C2H6/c12-6-5-9-10(13)11-7-3-1-2-4-8(7)14-9;2*1-2/h1-4,9,12H,5-6H2,(H,11,13);2*1-2H3 |
| InChIKey | OLJHNLABGHNBMV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |