C15H14N2O4 — CID 110404630
N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]furan-2-carboxamide (PubChem CID 110404630) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]furan-2-carboxamide.
| Compound Name | N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110404630 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCC1Oc2ccccc2NC1=O)c1ccco1 |
| InChI | InChI=1S/C15H14N2O4/c18-14(12-6-3-9-20-12)16-8-7-13-15(19)17-10-4-1-2-5-11(10)21-13/h1-6,9,13H,7-8H2,(H,16,18)(H,17,19) |
| InChIKey | PJGVIBAFLLIWFN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |