C24H23N3O3 — CID 9226903
N',N'-dibenzyl-2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetohydrazide (PubChem CID 9226903) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is N',N'-dibenzyl-2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetohydrazide.
| Compound Name | N',N'-dibenzyl-2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 9226903 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N',N'-dibenzyl-2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetohydrazide |
| SMILES | O=C(C[C@@H]1Oc2ccccc2NC1=O)NN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H23N3O3/c28-23(15-22-24(29)25-20-13-7-8-14-21(20)30-22)26-27(16-18-9-3-1-4-10-18)17-19-11-5-2-6-12-19/h1-14,22H,15-17H2,(H,25,29)(H,26,28)/t22-/m0/s1 |
| InChIKey | XZMVQGQZPHYEAX-QFIPXVFZSA-N |
| XLogP | 3.51 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|