C17H21N3O4 — CID 9327309
N'-[2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]cyclohexanecarbohydrazide (PubChem CID 9327309) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is N'-[2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]cyclohexanecarbohydrazide.
| Compound Name | N'-[2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]cyclohexanecarbohydrazide |
|---|---|
| PubChem CID | 9327309 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N'-[2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]cyclohexanecarbohydrazide |
| SMILES | O=C(C[C@H]1Oc2ccccc2NC1=O)NNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C17H21N3O4/c21-15(19-20-16(22)11-6-2-1-3-7-11)10-14-17(23)18-12-8-4-5-9-13(12)24-14/h4-5,8-9,11,14H,1-3,6-7,10H2,(H,18,23)(H,19,21)(H,20,22)/t14-/m1/s1 |
| InChIKey | NAGGENZZWSVAMS-CQSZACIVSA-N |
| XLogP | 1.50 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|