C17H15FN4O3S — CID 9278321
1-(2-fluorophenyl)-3-[[2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]amino]thiourea (PubChem CID 9278321) has the molecular formula C17H15FN4O3S and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[[2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]amino]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[[2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 9278321 |
| Molecular Formula | C17H15FN4O3S |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[[2-[(2S)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]amino]thiourea |
| SMILES | O=C(C[C@@H]1Oc2ccccc2NC1=O)NNC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C17H15FN4O3S/c18-10-5-1-2-6-11(10)20-17(26)22-21-15(23)9-14-16(24)19-12-7-3-4-8-13(12)25-14/h1-8,14H,9H2,(H,19,24)(H,21,23)(H2,20,22,26)/t14-/m0/s1 |
| InChIKey | WVZIASYCITYXJO-AWEZNQCLSA-N |
| XLogP | 1.93 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|