C18H15N3O6 — CID 9273964
N'-[2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 9273964) has the molecular formula C18H15N3O6 and a molecular weight of 369.33 g/mol. Its IUPAC name is N'-[2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 9273964 |
| Molecular Formula | C18H15N3O6 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N'-[2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(C[C@H]1Oc2ccccc2NC1=O)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15N3O6/c22-16(8-15-18(24)19-11-3-1-2-4-12(11)27-15)20-21-17(23)10-5-6-13-14(7-10)26-9-25-13/h1-7,15H,8-9H2,(H,19,24)(H,20,22)(H,21,23)/t15-/m1/s1 |
| InChIKey | RRDWYCQCPBLBDM-OAHLLOKOSA-N |
| XLogP | 0.97 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|