C16H22N4O3S — CID 9187878
1-[[2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]amino]-3-pentylthiourea (PubChem CID 9187878) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 1-[[2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]amino]-3-pentylthiourea.
| Compound Name | 1-[[2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]amino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9187878 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1-[[2-[(2R)-3-oxo-4H-1,4-benzoxazin-2-yl]acetyl]amino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NNC(=O)C[C@H]1Oc2ccccc2NC1=O |
| InChI | InChI=1S/C16H22N4O3S/c1-2-3-6-9-17-16(24)20-19-14(21)10-13-15(22)18-11-7-4-5-8-12(11)23-13/h4-5,7-8,13H,2-3,6,9-10H2,1H3,(H,18,22)(H,19,21)(H2,17,20,24)/t13-/m1/s1 |
| InChIKey | SEYJIJIYGIZPLZ-CYBMUJFWSA-N |
| XLogP | 1.46 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|