About N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide
N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide (PubChem CID 110404623) has the molecular formula C15H20N2O3
and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide.
Molecular Properties
| Compound Name | N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide |
| PubChem CID | 110404623 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCC1Oc2ccccc2NC1=O |
| InChI | InChI=1S/C15H20N2O3/c1-2-3-8-14(18)16-10-9-13-15(19)17-11-6-4-5-7-12(11)20-13/h4-7,13H,2-3,8-10H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | LCUAZRLRHWRSCU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide?
The IUPAC name of N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide (CID 110404623) is N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide.
What is the SMILES notation for N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide?
The canonical SMILES for N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide is CCCCC(=O)NCCC1Oc2ccccc2NC1=O.
What is the InChIKey of N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide?
The InChIKey is LCUAZRLRHWRSCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-2-3-8-14(18)16-10-9-13-15(19)17-11-6-4-5-7-12(11)20-13/h4-7,13H,2-3,8-10H2,1H3,(H,16,18)(H,17,19).
What are the key properties of N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide?
N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide has a molecular weight of 276.34 g/mol, XLogP of 2.08, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]pentanamide is sourced from PubChem (CID 110404623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).