C16H16N2O3S — CID 17488895
2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 17488895) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 17488895 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-(3-oxo-4H-1,4-benzoxazin-2-yl)-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(CC1Oc2ccccc2NC1=O)NCCc1cccs1 |
| InChI | InChI=1S/C16H16N2O3S/c19-15(17-8-7-11-4-3-9-22-11)10-14-16(20)18-12-5-1-2-6-13(12)21-14/h1-6,9,14H,7-8,10H2,(H,17,19)(H,18,20) |
| InChIKey | KZJKNJYKUROTLR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |