C16H15NO — CID 154948076
3-ethenyl-2-[(1E,3Z)-hexa-1,3,5-trienyl]-4H-1,4-benzoxazine (PubChem CID 154948076) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-ethenyl-2-[(1E,3Z)-hexa-1,3,5-trienyl]-4H-1,4-benzoxazine.
| Compound Name | 3-ethenyl-2-[(1E,3Z)-hexa-1,3,5-trienyl]-4H-1,4-benzoxazine |
|---|---|
| PubChem CID | 154948076 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-ethenyl-2-[(1E,3Z)-hexa-1,3,5-trienyl]-4H-1,4-benzoxazine |
| SMILES | C=C/C=C\C=C\C1=C(C=C)Nc2ccccc2O1 |
| InChI | InChI=1S/C16H15NO/c1-3-5-6-7-11-15-13(4-2)17-14-10-8-9-12-16(14)18-15/h3-12,17H,1-2H2/b6-5-,11-7+ |
| InChIKey | AIQGZGFRPVQLGH-GNLLZQBYSA-N |
| XLogP | 4.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|