C18H28O2 — CID 144875800
2,3-bis(ethenyl)-1,4-benzodioxine;ethane (PubChem CID 144875800) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1,4-benzodioxine;ethane.
| Compound Name | 2,3-bis(ethenyl)-1,4-benzodioxine;ethane |
|---|---|
| PubChem CID | 144875800 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 2,3-bis(ethenyl)-1,4-benzodioxine;ethane |
| SMILES | C=CC1=C(C=C)Oc2ccccc2O1.CC.CC.CC |
| InChI | InChI=1S/C12H10O2.3C2H6/c1-3-9-10(4-2)14-12-8-6-5-7-11(12)13-9;3*1-2/h3-8H,1-2H2;3*1-2H3 |
| InChIKey | GNEQUOSNLPTBEV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |