About 2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane
2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane (PubChem CID 143559626) has the molecular formula C18H25NO
and a molecular weight of 271.40 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane.
Molecular Properties
| Compound Name | 2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane |
| PubChem CID | 143559626 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane |
| SMILES | C=CC1=C(C=C)C(C)=Nc2ccccc2O1.CC.CC |
| InChI | InChI=1S/C14H13NO.2C2H6/c1-4-11-10(3)15-12-8-6-7-9-14(12)16-13(11)5-2;2*1-2/h4-9H,1-2H2,3H3;2*1-2H3 |
| InChIKey | GGAQKJIPADTIPJ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane?
The IUPAC name of 2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane (CID 143559626) is 2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane.
What is the SMILES notation for 2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane?
The canonical SMILES for 2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane is C=CC1=C(C=C)C(C)=Nc2ccccc2O1.CC.CC.
What is the InChIKey of 2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane?
The InChIKey is GGAQKJIPADTIPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO.2C2H6/c1-4-11-10(3)15-12-8-6-7-9-14(12)16-13(11)5-2;2*1-2/h4-9H,1-2H2,3H3;2*1-2H3.
What are the key properties of 2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane?
2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane has a molecular weight of 271.40 g/mol, XLogP of 5.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)-4-methyl-1,5-benzoxazepine;ethane is sourced from PubChem (CID 143559626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).